{{cart_num}}
My Cart
CAS：2869-83-2
Storage：Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥97%
Appearance：Brown to dark brown Solid
Qty：
Size：
| CAS | 2869-83-2 |
| Name | Janus green B |
| Molecular Formula | C30H31ClN6 |
| Molecular Weight | 511.07 |
| Solubility | Soluble in Water ≥5mg/mL |
| Purity | ≥97% |
| Appearance | Brown to dark brown Solid |
| Storage | Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| EC | EINECS 220-695-6 |
| MDL | MFCD00011758 |
| SMILES | CCN(CC)C1=CC2=[N+](C3=C(C=CC(=C3)N=NC4=CC=C(C=C4)N(C)C)N=C2C=C1)C5=CC=CC=C5.[Cl-] |
| InChIKey | XXACTDWGHQXLGW-UHFFFAOYSA-M |
| InChI | InChI=1S/C30H31N6.ClH/c1-5-35(6-2)26-17-19-28-30(21-26)36(25-10-8-7-9-11-25)29-20-23(14-18-27(29)31-28)33-32-22-12-15-24(16-13-22)34(3)4;/h7-21H，5-6H2，1-4H3;1H/q+1;/p-1 |
| PubChem CID | 76123 |
| Background | Janus green B is an ex vivo liveness stain. The staining reaction of Janus green B is oxygen-dependent and reversibly inhibited by cyanide. |
| Unit | Bottle |
| Specification | 100mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Sorry, there is no more information.
