{{cart_num}}
My CartCAS：10016-20-3
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：White to off-white Solid
Qty：
Size：
| CAS | 10016-20-3 |
| Name | α-Cyclodextrin |
| Molecular Formula | C36H60O30 |
| Molecular Weight | 972.84 |
| Solubility | Soluble in DMSO/Water ≥5mg/mL(Need ultrasonic) |
| Purity | ≥98% |
| Appearance | White to off-white Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| EC | EINECS 233-007-4 |
| MDL | MFCD00078207 |
| SMILES | C(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(O2)C(C7O)O)CO)CO)CO)CO)CO)O)O)O |
| InChIKey | HFHDHCJBZVLPGP-RWMJIURBSA-N |
| InChI | InChI=1S/C36H60O30/c37-1-7-25-13(43)19(49)31(55-7)62-26-8(2-38)57-33(21(51)15(26)45)64-28-10(4-40)59-35(23(53)17(28)47)66-30-12(6-42)60-36(24(54)18(30)48)65-29-11(5-41)58-34(22(52)16(29)46)63-27-9(3-39)56-32(61-25)20(50)14(27)44/h7-54H，1-6H2/t7-，8-，9-，10-，11-，12-，13-，14-，15-，16-，17-，18-，19-，20-，21-，22-，23-，24-，25-，26-，27-，28-，29-，30-，31-，32-，33-，34-，35-，36-/m1/s1 |
| PubChem CID | 444913 |
| Target Point | 4 glucoside bonds in a barrel-like shape. A hydrophobic cavity is formed in the barrel |
| Passage | which can absorb hydrophobic small molecules or groups of a certain size and shape to form a stable non-covalent complex. Cyclodextrins can bind with many kinds of guest because of their special structure of ""hydrophilic outside |
| Background | The molecular structure of cyclodextrin is formed by more than 6 dextroses connected by α-1, 4 glucoside bonds in a barrel-like shape. A hydrophobic cavity is formed in the barrel, which can absorb hydrophobic small molecules or groups of a certain size and shape to form a stable non-covalent complex. Cyclodextrins can bind with many kinds of guest because of their special structure of "hydrophilic outside, hydrophobic inside" and excellent non-toxic properties. Cyclodextrins that consist of six, seven, and eight glucose monomers connected by alpha-1, 4-glucoside bonds are called α-cyclodextrins, β-cyclodextrins, and γ-cyclodextrins. |
| IC50 | hydrophobic inside"" and excellent non-toxic properties. Cyclodextrins that consist of six |
| In Vitro | seven |
| In Vivo | and eight glucose monomers connected by alpha-1 |
| Cell Experiment | 4-glucoside bonds are called α-cyclodextrins |
| Animal Experiment | β-cyclodextrins |
| Kinase Experiment | and γ-cyclodextrins." |
| Unit | Bottle |
| Specification | 1g 5g |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Manual Download
