{{cart_num}}
My CartCAS：1448297-52-6
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：HPLC≥98%
Appearance：White to light yellow Solid
Qty：
Size：
| CAS | 1448297-52-6 |
| Name | (S,R,S)-AHPC |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.56 |
| Solubility | Soluble in DMSO ≥5mg/mL(Need ultrasonic) |
| Purity | HPLC≥98% |
| Appearance | White to light yellow Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| MDL | MFCD30502992 |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)CNC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)N)O |
| InChIKey | ZLOXMSNKPDWMEF-ZIFCJYIRSA-N |
| InChI | InChI=1S/C22H30N4O3S/c1-13-18(30-12-25-13)15-7-5-14(6-8-15)10-24-20(28)17-9-16(27)11-26(17)21(29)19(23)22(2，3)4/h5-8，12，16-17，19，27H，9-11，23H2，1-4H3，(H，24，28)/t16-，17+，19-/m1/s1 |
| PubChem CID | 89702519 |
| Target Point | Others |
| Passage | Others |
| Background | (S,R,S)-AHPC is a VH032-based VHL ligand for recruitment of von Hippel-Lindau (VHL) proteins. (S,R,S)-AHPC can be connected to the target protein ligand through linkers to form PROTAC molecules. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
